| Mã | Cas | Tên gọi | Công thức | Đơn giá | Chi tiết |
|---|---|---|---|---|---|
| A864212 | 9073-63-6 |
Rượu oxyase dung dịch đệm, 10-40 đơn vị / mg protein (biuret)
Alcohol Oxidase |
7,800,000đ | Chi tiết | |
| C864257 | 9026-00-0 |
Cholesterol esterase từ tuyến tụy lợn ≥300 đơn vị / g trọng lượng khô
Cholesterol Esterase from porcine pancreas |
6,876,000đ | Chi tiết | |
| P863508 | 9025-82-5 |
Phosphodiesterase I có nguồn gốc từ nọc độc Đông Diamondback ≥20 đơn vị / mg trọng lượng khô
Phosphodiesterase I from Crotalus adamanteus venom |
13,428,000đ | Chi tiết | |
| T864180 | 9002-09-9 |
Tyrosine decarboxylase từ Streptococcus faecalis (NCTC6783) (trang phục) .20,2 đơn vị / mg
Tyrosine Decarboxylase from Streptococcus faecalis(NCTC6783)(Apoenzyme) |
6,072,000đ | Chi tiết | |
| D810527 | 56-73-5 |
D-glucose-6-phosphate ~ 1 M trong H2O (260 mg / ml)
D-Glucose 6-phosphate |
C6H13O9P | 4,320,000đ | Chi tiết |
| A864805 | 7783-20-2 |
Amoni sunfat cơ sở kim loại 99,9%
Ammonium sulfate |
H8N2O4S | 1,788,000đ | Chi tiết |
| D864803 | 35510-03-3 |
1,5-dibromo-2,4-dibromomethylbenzene 97%
1，5-Dibromo-2，4-bis(bromomethyl)benzene |
C8H6Br4 | 1,968,000đ | Chi tiết |
| T864802 | 580-35-8 |
2,4,6-triphenylpyridine 95%
2，4，6-Triphenylpyridine |
C23H17N | 2,208,000đ | Chi tiết |
| I862606 | 696-29-7 |
Isopropylcyclohexane ≥99% (GC)
Isopropylcyclohexane |
C9H18 | 912,000đ | Chi tiết |
| B863583 | 35059-50-8 |
Tert-butyl diazoacetate ≥80%
tert-Butyl diazoacetate |
N2CHCO2C(CH3)3 | 1,728,000đ | Chi tiết |
| D859407 | 6297-03-6 |
Dioctadecyl ether > 95,0% (GC)
Dioctadecyl Ether |
C36H74O | 2,088,000đ | Chi tiết |
| D864800 | 124-40-3 |
Dung dịch nước Dimethylamine dung dịch 2.0 M trong dung dịch THF, MkSeal
Dimethylamine solution |
C2H7N | 1,608,000đ | Chi tiết |
| B864799 | 5538-94-3 |
Dioctyl dimethyl ammonium clorua 80%
Bisoctyl Dimethyl Ammonium Chloride |
C18H40ClN | 2,568,000đ | Chi tiết |
| M859359 | 1754-62-7 |
Trans-methyl cinnamate 99%
Methyl trans-cinnamate |
C10H10O2 | 1,128,000đ | Chi tiết |
| A837849 | 111-45-5 |
2-Allyloxyethanol 98%
2-Allyloxyethanol |
C5H10O2 | 588,000đ | Chi tiết |
| T838671 | 10193-96-1 |
Trimethylpropane tris (axit 2-mercaptoacetic) 80%
Trimethylolpropane Tris(thioglycolate) |
C12H20O6S3 | 768,000đ | Chi tiết |
| B836552 | 516-02-9 |
Oxalic axit oxalate 99,999% kim loại cơ bản
Barium oxalate |
C2BaO4 | 996,000đ | Chi tiết |
| B864798 | 516-02-9 |
Oxalic axit oxalate 99% kim loại cơ bản
Barium oxalate |
C2BaO4 | 2,880,000đ | Chi tiết |
| E864797 | 3025-30-7 |
Este etyl 2,4-decadienoic ≥95%
Ethyl 2-trans-4-cis-decadienoate |
CH3(CH2)4CH=CHCH=CHCO2C2H5 | 1,788,000đ | Chi tiết |
| C837843 | 75279-55-9 |
2-Chloro-6-fluorobenzonitrile 98%
2-Chloro-6-fluorophenylacetonitrile |
C8H5ClFN | 2,076,000đ | Chi tiết |
| B864796 | 1126824-44-9 |
5-bromo-7-methoxyquinoline 96%
5-bromo-7-methoxyquinoline |
C10H8BrNO | 13,680,000đ | Chi tiết |
| B864795 | 67-52-7 |
Axit barbituric 99%
Barbituric acid |
C4H4N2O3 | 960,000đ | Chi tiết |
| P864794 | 298-14-6 |
Kali bicarbonate cơ sở kim loại 99,9%
Potassium bicarbonate |
KHCO3 | 792,000đ | Chi tiết |
| D864793 | 107-64-2 |
Dimethyldioctadecyl ammonium clorua 75%
Dimethyldioctadecylammonium chloride |
C38H80ClN | 852,000đ | Chi tiết |
| T857371 | 856867-55-5 |
Tertidazole phosphate 99,5%, đơn linh tinh <0,1%
Torezolid phosphate |
C17H16FN6O6P | 7,200,000đ | Chi tiết |
| F864792 | 50-00-0 |
Dung dịch formaldehyd AR, 18% trọng lượng trong H 2, chứa 5-8% chất ổn định metanol
Formaldehyde solution |
CH2O | 348,000đ | Chi tiết |
| C864790 | 471-34-1 |
Canxi cacbonat cơ sở kim loại 99,9%
Calcium carbonate |
CaCO3 | 768,000đ | Chi tiết |
| I864789 | 7782-61-8 |
Sắt (III) nitrat nonahydrat cơ sở kim loại 99,9%
Iron(III) nitrate nonahydrate |
FeN3O9·9H2O | 588,000đ | Chi tiết |
| V836749 | 7718-98-1 |
Vanadi (III) clorua 99% kim loại cơ bản
Vanadium(III) chloride |
Cl3V | 1,152,000đ | Chi tiết |
| D864787 | 49607-01-4 |
D-cyclopropylglycine 98%
D-Cyclopropylglycine |
C5H9NO2 | 5,208,000đ | Chi tiết |
| N828085 | 53075-09-5 |
N, N, N-trimethyl-1-adamantyl ammonium hydroxide 25% dung dịch nước
N，N，N-Trimethyl-1-adamantylammonium Hydroxide |
C13H25NO | 1,176,000đ | Chi tiết |
| M864786 | 767-58-8 |
1-methyl indane 95%
1-Methylindan |
C10H12 | 2,016,000đ | Chi tiết |
| L812635 | 12060-01-4 |
Chì zirconate (II) 99,7% kim loại cơ bản (trừ Hf), Hf 1%
Lead(II) zirconate |
PbZrO3 | 1,320,000đ | Chi tiết |
| E830978 | 110-73-6 |
N-ethylethanolamine 98%
2-(Ethylamino)ethanol |
C4H11NO | 852,000đ | Chi tiết |
| Z864785 | 7646-85-7 |
Dung dịch kẽm clorua dung dịch 0,7 M trong THF, nước≤1000ppm, MkSeal
Zinc chloride solution |
ZnCl2 | 7,200,000đ | Chi tiết |
| B824362 | 166412-78-8 |
Cyclohexane-1,2-dicarboxylic axit diisononyl ester 98%
Bis(7-methyloctyl) cyclohexane-1，2-dicarboxylate |
C26H48O4 | 1,008,000đ | Chi tiết |
| D864784 | 462-20-4 |
Axit dihydrolipoic ≥97%
Dihydrolipoic Acid |
C8H16O2S2 | 2,868,000đ | Chi tiết |
| I836117 | 1345-25-1 |
Ôxít sắt (II) 98%
Iron(II) oxide |
FeO | 1,788,000đ | Chi tiết |
| F864783 | 65997-17-3 |
Bông thủy tinh dùng trong phòng thí nghiệm
Fiber Glass Wool |
O2Si | 2,760,000đ | Chi tiết |
| T822972 | 10031-24-0 |
Tin (II) bromide 99%
Tin(II) bromide |
SnBr2 | 792,000đ | Chi tiết |
| A864782 | 75-05-8 |
Acetonitril khan 99,9%, Water≤50 ppm (bởi K.F.), MkSeal
anhydrous Acetonitrile |
C2H3N | 3,888,000đ | Chi tiết |
| F832295 | 7660-25-5 |
Fructose
Fructose |
C6H12O6 | 1,176,000đ | Chi tiết |
| V864781 | 1314-34-7 |
Vanadi oxit (III) 99%
Vanadium(III) oxide |
V2O3 | 1,248,000đ | Chi tiết |
| B836767 | 7787-58-8 |
Barium bromide ≥98%
Bismuth(III) bromide |
BiBr3 | 1,056,000đ | Chi tiết |
| C864780 | 2420-56-6 |
Axit linoleic liên hợp hỗn hợp đồng phân, 80%
Conjugated Linoleic acid |
C18H32O2 | 960,000đ | Chi tiết |
| B860065 | 5736-89-0 |
4 - (n-butoxy) acetophenone 98%
1-(4-Butoxyphenyl)ethanone |
C12H16O2 | 876,000đ | Chi tiết |
| H863029 | 592-43-8 |
2-hexene (hỗn hợp đồng phân cis-trans) ≥98% (GC)
2-Hexene (cis- and trans- mixture) |
C6H12 | 11,070,000đ | Chi tiết |
| C838769 | 610-40-2 |
3,4-Dinitrochlorobenzene 90%
1-Chloro-3，4-dinitrobenzene |
C6H3ClN2O4 | 708,000đ | Chi tiết |
| A858199 | 645-92-1 |
Axit Cyanuric 95%
Ammeline |
C3H5N5O | 2,208,000đ | Chi tiết |
| C806195 | 608-23-1 |
3-chloro-o-xylene ≥97.0%
3-Chloro-o-xylene |
C8H9Cl | 876,000đ | Chi tiết |
| C838161 | 56456-50-9 |
Rượu 2-clo-6-fluorobenzyl 97%
2-Chloro-6-fluorobenzyl alcohol |
C7H6ClFO | 534,000đ | Chi tiết |
| S858391 | 2325-10-2 |
(S, S) - (-) - Benzoin hydro hóa 99%
(S，S)-(-)-Hydrobenzoin |
C14H14O2 | 1,716,000đ | Chi tiết |
| S831485 | 481-06-1 |
蛔 素素 98%
SANTONIN |
C15H18O3 | 1,188,000đ | Chi tiết |
| D830639 | 2735-04-8 |
2,4-dimethoxyaniline 98%
2，4-Dimethoxyaniline |
C8H11NO2 | 696,000đ | Chi tiết |
| A823483 | 129741-57-7 |
Pulsatilla saponin B4 Tài liệu tham khảo phân tích
Anemoside B4 |
C59H96O26 | 7,680,000đ | Chi tiết |
| D864776 | 9004-53-9 |
Dextrin AR, từ ngô
Dextrin |
[C6H10O5]n | 216,000đ | Chi tiết |
| A864775 | 631-61-8 |
Amoni axetat 99,9% kim loại cơ bản
Ammonium acetate |
C2H7NO2 | 468,000đ | Chi tiết |
| T864774 | 127-18-4 |
Tetrachloretylen Phân tích hồng ngoại
Tetrachloroethylene |
C2Cl4 | 2,208,000đ | Chi tiết |
| F864773 | 98-00-0 |
Hydroxide 95%
Furfuryl alcohol |
C5H6O2 | 396,000đ | Chi tiết |
| C864772 | 88-73-3 |
o-chloronitrobenzene 95%
o-Chloronitrobenzene |
C6H4ClNO2 | 768,000đ | Chi tiết |
| N864771 | 123-39-7 |
N-methylformamide 97%
N-Methylformamide |
C2H5NO | 576,000đ | Chi tiết |
| T850102 | LZRY |
Dung dịch chuẩn ion ion 100μg / mL, 10% HCl
Tin ion standard solution |
1,452,000đ | Chi tiết | |
| S864770 | 14808-60-7 |
Cát thạch anh AR, 200-250 lưới, trắng
Silica sand |
SiO2 | 960,000đ | Chi tiết |
| D832127 | 293311-03-2 |
4 - (4,6-Dimethoxytriazin-2-yl) -4-methylmoroline tetrafluorobISE 98%
4-(4，6-Dimethoxy-1，3，5-triazin-2-yl)-4-morpholinium tetrafluoroborate |
C9H15BF4N4O3 | 480,000đ | Chi tiết |
| C864769 | 5743-04-4 |
Cadmium acetate dihydrat 99,9% kim loại cơ bản
Cadmium acetate dihydrate |
C4H6CdO4·2H2O | 960,000đ | Chi tiết |
| A864768 | NONE6694 |
Dung dịch kiềm glycoside 50%
Alkylpolyglycoside |
4,008,000đ | Chi tiết | |
| A864767 | 1912-24-9 |
Dung dịch chuẩn atrazine 100 g / ml; ma trận: metanol
Atrazine solution |
C8H14ClN5 | 1,038,000đ | Chi tiết |
| D864766 | 75-35-4 |
1,1-dichloroetylen 99,9%
1，1-Dichloroethene |
C2H2C12 | 1,308,000đ | Chi tiết |
| C836468 | 3518-65-8 |
Cloromethylsulfonyl clorua 95%
Chloromethanesulfonyl chloride |
CH2Cl2O2S | 1,728,000đ | Chi tiết |
| M833972 | 21142-29-0 |
3- (triethoxysilyl) propyl methacryit (chứa chất ổn định BHT) 98%
3-(Triethoxysilyl)propyl Methacrylate (stabilized with BHT) |
C13H26O5Si | 2,748,000đ | Chi tiết |
| D830587 | 1656-44-6 |
2,4-Dinitrobenzenesulfonyl clorua 98%
2，4-Dinitrobenzenesulfonyl chloride |
C6H3ClN2O6S | 1,176,000đ | Chi tiết |
| C836323 | 21907-50-6 |
Barium trifluoroacetate
Cesium trifluoroacetate |
C2CsF3O2 | 948,000đ | Chi tiết |
| P864764 | 6317-73-3 |
4-phenoxybenzophenone 95%
4-Phenoxybenzophenone |
C19H14O2 | 996,000đ | Chi tiết |
| C850055 | 62-54-4 |
Canxi axetat 99%
Calcium Acetate |
C4H6CaO4 | 534,000đ | Chi tiết |
| C864763 | 50960-82-2 |
Quỹ chlorocarbonyl (I) 99%
Chlorocarbonylgold(I) |
CAuClO | 13,284,000đ | Chi tiết |
| H864762 | 50930-23-9 |
1-heptadecanoyl-glycerol-3-phosphorylcholine > 99%
1-heptadecanoyl-2-hydroxy-sn-glycero-3-phosphocholine |
C25H52NO7P | 7,548,000đ | Chi tiết |
| D864761 | 474943-13-0 |
Dioctanoylglycerol pyrophosphate (muối amoni) > 99%
dioctanoylglycerol pyrophosphate (ammonium salt) |
C19H44N2O11P2 | 22,668,000đ | Chi tiết |
| D864760 | 467214-21-7 |
17-DMAG (Alvespimycin) HCl ≥98%
17-DMAG (Alvespimycin) HCl |
C32H48N4O8•HCl | 5,700,000đ | Chi tiết |
| L864759 | 41639-83-2 |
LatanoprostAcid ≥98%
LatanoprostAcid |
C23H34O5 | 8,298,000đ | Chi tiết |
| N864758 | 4125-98-8 |
N-methyl L-isoleucine 98,0%
N-Methyl-L-isoleucine |
C7H15NO2 | 6,120,000đ | Chi tiết |
| F864757 | 4093-49-6 |
Fumaraldehyd mono (dimethyl acetal) (chứa chất ổn định HQ) > 95,0% (GC)
Fumaraldehyde Mono(dimethyl Acetal) (stabilized with HQ) |
C6H10O3 | 14,286,000đ | Chi tiết |
| F864756 | 403811-55-2 |
10058-F4 ≥97%
10058-F4 |
C12H11NOS2 | 8,304,000đ | Chi tiết |
| L864755 | 383907-32-2 |
L-α-phosphatidylserine (Brain, porcine) (muối natri) > 99%
L-α-phosphatidylserine (Brain， Porcine) (sodium salt) |
C42H79NNaO10P | 7,212,000đ | Chi tiết |
| B864753 | 37526-88-8 |
Benzyl phthalate 97%
Benzyl tiglate |
C12H14O2 | 2,928,000đ | Chi tiết |
| S864752 | 36603-80-2 |
Natri xyanomethomide > 98,0% (T)
Sodium Tricyanomethanide |
C4N3Na | 2,004,000đ | Chi tiết |
| D864751 | 3355-27-9 |
1,2-dipentadecanoyl-sn-glycero-3-phosphocholine > 99%
1，2-dipentadecanoyl-sn-glycero-3-phosphocholine |
C38H76NO8P | 4,428,000đ | Chi tiết |
| S864748 | 325466-03-3 |
Bis (monomyristoylglycero) phosphate (S, R Isome) (muối amoni) > 99%
bis(monomyristoylglycero)phosphate (S，R Isomer) (ammonium salt) |
C34H70NO10P | 36,108,000đ | Chi tiết |
| S864747 | 325465-92-7 |
1-stearoyl-2-hydroxy-sn-glycero-3-phosphate (muối natri) > 99%
1-stearoyl-2-hydroxy-sn-glycero-3-phosphate (sodium salt) |
C21H42O7PNa | 11,748,000đ | Chi tiết |
| D864744 | 321883-54-9 |
1,2-dioctanoyl-sn-glycero-3-phosphate (muối natri) > 99%
1，2-dioctanoyl-sn-glycero-3-phosphate (sodium salt) |
C19H36O8PNa | 5,028,000đ | Chi tiết |
| S864743 | 312696-30-3 |
Natri phosphotungstate hydrat AR
Sodium phosphotungstate hydrate |
Na3O40PW12·xH2O | 696,000đ | Chi tiết |
| D864742 | 298-03-3 |
Dung dịch chuẩn phospho-O được hấp thụ bên trong 1000μg / ml, hòa tan trong dung dịch metanol thu được
Demeton-O solution |
C8H19O3PS2 | 5,280,000đ | Chi tiết |
| N864741 | 279-23-2 |
Norbornane > 98,0% (GC)
Norbornane |
C7H12 | 5,028,000đ | Chi tiết |
| D864740 | 27869-47-2 |
1,2-diundecanoyl-sn-glycero-3-phosphocholine > 99%
1，2-diundecanoyl-sn-glycero-3-phosphocholine |
C30H60NO8P | 5,448,000đ | Chi tiết |
| M864739 | 273931-53-6 |
1-myristoyl-2- (4-nitrophenylsuccinyl) -sn-glycero-3-phosphocholine > 99%
1-myristoyl-2-(4-nitrophenylsuccinyl)-sn-glycero-3-phosphocholine |
C32H53N2O12P | 44,340,000đ | Chi tiết |
| D864738 | 25582-63-2 |
1,2-dipalmitoyl-d62-sn-glycero-3-phosphocholine > 99%
1，2-dipalmitoyl-d62-sn-glycero-3-phosphocholine |
C40H18NO8PD62 | 28,716,000đ | Chi tiết |
| P864737 | 253124-08-2 |
2-propyl-4- (4-pyridylazo) phenol > 98,0% (HPLC)
2-Propyl-4-(4-pyridylazo)phenol |
C14H15N3O | 15,042,000đ | Chi tiết |
| D864736 | 240129-43-5 |
7β, 27-dihydroxycholesterol > 99%
7β，27-dihydroxycholesterol |
C27H46O3 | 37,536,000đ | Chi tiết |
| L864735 | 23973-20-8 |
Lactose Octaacetate ≥98%
Lactose Octaacetate |
C28H38O19 | 3,348,000đ | Chi tiết |
| P864734 | 20069-09-4 |
荜 amide ≥97% (HPLC)
Piperlongumine |
C17H19NO5 | 7,212,000đ | Chi tiết |
| I864733 | 199444-11-6 |
IR-775 clorua > 90,0% (N)
IR 775 Chloride |
C32H36Cl2N2 | 3,768,000đ | Chi tiết |
